* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5884043 |
English Synonyms: | ABAMACHEM ABA-5884043 |
MDL Number.: | MFCD18022544 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)nc(n2CCO)c3csc(n3)N |
InChi: | InChI=1S/C12H12N4OS/c13-12-15-9(7-18-12)11-14-8-3-1-2-4-10(8)16(11)5-6-17/h1-4,7,17H,5-6H2,(H2,13,15) |
InChiKey: | InChIKey=KITVPIIUACXXDG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.