* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5885743 |
English Synonyms: | ABAMACHEM ABA-5885743 |
MDL Number.: | MFCD18024126 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CCCNC(=O)CCNC(=O)Cc1csc(n1)N |
InChi: | InChI=1S/C11H18N4O2S/c1-2-4-13-9(16)3-5-14-10(17)6-8-7-18-11(12)15-8/h7H,2-6H2,1H3,(H2,12,15)(H,13,16)(H,14,17) |
InChiKey: | InChIKey=MIGDDKVPOJNEFY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.