* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5886042 |
English Synonyms: | ABAMACHEM ABA-5886042 |
MDL Number.: | MFCD18024423 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1c(sc(n1)NC(=O)C2COCCO2)C#CCCO |
InChi: | InChI=1S/C12H14N2O4S/c15-4-2-1-3-9-7-13-12(19-9)14-11(16)10-8-17-5-6-18-10/h7,10,15H,2,4-6,8H2,(H,13,14,16) |
InChiKey: | InChIKey=UQTSXIJOKPRIHC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.