* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5886284 |
English Synonyms: | ABAMACHEM ABA-5886284 |
MDL Number.: | MFCD18024663 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1c(cc(o1)C(=O)O)S(=O)(=O)N2CCSCC2 |
InChi: | InChI=1S/C10H13NO5S2/c1-7-9(6-8(16-7)10(12)13)18(14,15)11-2-4-17-5-3-11/h6H,2-5H2,1H3,(H,12,13) |
InChiKey: | InChIKey=OBYUAMLFBCLBMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.