* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(2-ETHOXYACETYL)-1,3,8-TRIAZASPIRO[4.5]DECANE-2,4-DIONE |
English Synonyms: | 8-(2-ETHOXYACETYL)-1,3,8-TRIAZASPIRO[4.5]DECANE-2,4-DIONE |
MDL Number.: | MFCD18025163 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCOCC(=O)N1CCC2(CC1)C(=O)NC(=O)N2 |
InChi: | InChI=1S/C11H17N3O4/c1-2-18-7-8(15)14-5-3-11(4-6-14)9(16)12-10(17)13-11/h2-7H2,1H3,(H2,12,13,16,17) |
InChiKey: | InChIKey=GFBSDEPOGACZTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.