* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5889719 |
English Synonyms: | ABAMACHEM ABA-5889719 |
MDL Number.: | MFCD18027813 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCN(CC(C)C(=O)O)S(=O)(=O)CC(=O)OCC |
InChi: | InChI=1S/C10H19NO6S/c1-4-11(6-8(3)10(13)14)18(15,16)7-9(12)17-5-2/h8H,4-7H2,1-3H3,(H,13,14) |
InChiKey: | InChIKey=FOOKJSQWBQUQSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.