* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(4-CHLORO-6-METHOXY-1,3,5-TRIAZIN-2-YL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
English Synonyms: | 8-(4-CHLORO-6-METHOXY-1,3,5-TRIAZIN-2-YL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
MDL Number.: | MFCD18032031 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1nc(nc(n1)Cl)N2C3CCC2CC(C3)N |
InChi: | InChI=1S/C11H16ClN5O/c1-18-11-15-9(12)14-10(16-11)17-7-2-3-8(17)5-6(13)4-7/h6-8H,2-5,13H2,1H3 |
InChiKey: | InChIKey=RQOFELUQPSGISU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.