* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-AZABICYCLO[3.2.1]OCTANE, 3-(2-ETHYL-1H-BENZIMIDAZOL-1-YL)-, (3-EXO)- |
| CAS: | 478695-68-0 |
| English Synonyms: | 8-AZABICYCLO[3.2.1]OCTANE, 3-(2-ETHYL-1H-BENZIMIDAZOL-1-YL)-, (3-EXO)- |
| MDL Number.: | MFCD18072102 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCc1nc2ccccc2n1[C@@H]3C[C@H]4CC[C@@H](C3)N4 |
| InChi: | InChI=1S/C16H21N3/c1-2-16-18-14-5-3-4-6-15(14)19(16)13-9-11-7-8-12(10-13)17-11/h3-6,11-13,17H,2,7-10H2,1H3/t11-,12+,13- |
| InChiKey: | InChIKey=LXFHDWHJMGMGAK-CLLJXQQHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.