* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-AZABICYCLO[3.2.1]OCTANE, 3-(1H-BENZIMIDAZOL-1-YL)-, (3-EXO)- |
| CAS: | 478925-03-0 |
| English Synonyms: | 8-AZABICYCLO[3.2.1]OCTANE, 3-(1H-BENZIMIDAZOL-1-YL)-, (3-EXO)- |
| MDL Number.: | MFCD18072114 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)ncn2[C@H]3C[C@@H]4CC[C@H](C3)N4 |
| InChi: | InChI=1S/C14H17N3/c1-2-4-14-13(3-1)15-9-17(14)12-7-10-5-6-11(8-12)16-10/h1-4,9-12,16H,5-8H2/t10-,11+,12- |
| InChiKey: | InChIKey=OGOZBBGHZSRLBJ-ZSBIGDGJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.