* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO-3-IODOIMIDAZO[1,2-A]PYRAZINE |
| CAS: | 1245644-46-5 |
| English Synonyms: | 8-BROMO-3-IODOIMIDAZO[1,2-A]PYRAZINE |
| MDL Number.: | MFCD18072714 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cn2c(cnc2c(n1)Br)I |
| InChi: | InChI=1S/C6H3BrIN3/c7-5-6-10-3-4(8)11(6)2-1-9-5/h1-3H |
| InChiKey: | InChIKey=NOZCLAVGNUXSGX-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.