* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-CHLORO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-AMINE |
CAS: | 1245644-68-1 |
English Synonyms: | 8-CHLORO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-AMINE ; 8-CHLORO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-YLAMINE |
MDL Number.: | MFCD18072716 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(c2nc(nn2c1)N)Cl |
InChi: | InChI=1S/C6H5ClN4/c7-4-2-1-3-11-5(4)9-6(8)10-11/h1-3H,(H2,8,10) |
InChiKey: | InChIKey=MWSWBCKCTLMDKD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.