* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-IODO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-AMINE |
| CAS: | 1245648-97-8 |
| English Synonyms: | 8-IODO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-AMINE ; 8-IODO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-YLAMINE |
| MDL Number.: | MFCD18072718 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(c2nc(nn2c1)N)I |
| InChi: | InChI=1S/C6H5IN4/c7-4-2-1-3-11-5(4)9-6(8)10-11/h1-3H,(H2,8,10) |
| InChiKey: | InChIKey=TWHJYZNVKBUSQM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.