* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,2,4-TRIAZOLO[4,3-A]PYRIDIN-3-AMINE, 5-METHYL- |
CAS: | 5595-15-3 |
English Synonyms: | 1,2,4-TRIAZOLO[4,3-A]PYRIDIN-3-AMINE, 5-METHYL- ; 5-METHYL-1,2,4-TRIAZOLO[4,3-A]PYRIDIN-3-AMINE |
MDL Number.: | MFCD18073211 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1cccc2n1c(nn2)N |
InChi: | InChI=1S/C7H8N4/c1-5-3-2-4-6-9-10-7(8)11(5)6/h2-4H,1H3,(H2,8,10) |
InChiKey: | InChIKey=YPKWGJNGPQESDL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.