* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-IODO-2-METHYL-PYRAZOLO[1,5-A][1,3,5]TRIAZIN-4-YLAMINE |
| CAS: | 476468-42-5 |
| English Synonyms: | 8-IODO-2-METHYL-PYRAZOLO[1,5-A][1,3,5]TRIAZIN-4-YLAMINE ; 8-IODO-2-METHYLPYRAZOLO[1,5-A][1,3,5]TRIAZIN-4-AMINE |
| MDL Number.: | MFCD18073972 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1nc2c(cnn2c(n1)N)I |
| InChi: | InChI=1S/C6H6IN5/c1-3-10-5-4(7)2-9-12(5)6(8)11-3/h2H,1H3,(H2,8,10,11) |
| InChiKey: | InChIKey=VCUZZBWPXOCRQN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.