* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-IODO-3H,4H-PYRAZOLO[1,5-A][1,3,5]TRIAZIN-4-ONE |
CAS: | 147916-84-5 |
English Synonyms: | 8-IODO-3H-PYRAZOLO[1,5-A][1,3,5]TRIAZIN-4-ONE ; 8-IODO-3H,4H-PYRAZOLO[1,5-A][1,3,5]TRIAZIN-4-ONE |
MDL Number.: | MFCD18073976 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1c(c2nc[nH]c(=O)n2n1)I |
InChi: | InChI=1S/C5H3IN4O/c6-3-1-9-10-4(3)7-2-8-5(10)11/h1-2H,(H,7,8,11) |
InChiKey: | InChIKey=RMTOJUXMHWGEHX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.