* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8H-1-OXA-8-AZA-AS-INDACEN-4-YLAMINE |
CAS: | 863995-03-3 |
English Synonyms: | 8H-FURO[3,2-G]INDOL-4-AMINE ; 8H-1-OXA-8-AZA-AS-INDACEN-4-YLAMINE |
MDL Number.: | MFCD18074089 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1c[nH]c2c1cc(c3c2occ3)N |
InChi: | InChI=1S/C10H8N2O/c11-8-5-6-1-3-12-9(6)10-7(8)2-4-13-10/h1-5,12H,11H2 |
InChiKey: | InChIKey=ZMPZISFKRFHTGS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.