* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BENZYL-3-OXA-1,8-DIAZA-SPIRO[4.5]DECAN-2-ONE |
| English Synonyms: | 8-BENZYL-3-OXA-1,8-DIAZA-SPIRO[4.5]DECAN-2-ONE |
| MDL Number.: | MFCD18074228 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)CN2CCC3(CC2)COC(=O)N3 |
| InChi: | InChI=1S/C14H18N2O2/c17-13-15-14(11-18-13)6-8-16(9-7-14)10-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,15,17) |
| InChiKey: | InChIKey=BCDVRULCHQWISY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.