* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VCH-916 |
| CAS: | 1200133-34-1 |
| English Synonyms: | VCH-916/VCH916 ; VCH-916 |
| MDL Number.: | MFCD18074520 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC1CCC(CC1)C(=O)N(c2cc(sc2C(=O)[O-])C3=CCCCC3)[C@@H]4CC[C@H](CC4)OC.[K+] |
| InChi: | InChI=1S/C26H37NO4S.K/c1-17-8-10-19(11-9-17)25(28)27(20-12-14-21(31-2)15-13-20)22-16-23(32-24(22)26(29)30)18-6-4-3-5-7-18;/h6,16-17,19-21H,3-5,7-15H2,1-2H3,(H,29,30);/q;+1/p-1/t17?,19?,20-,21-; |
| InChiKey: | InChIKey=RYXIBQLRUHDYEE-QPLYODNISA-M |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.