Molecular Structure:
CCD No.:CCD03970449
YM 230888
CAS No.:
446257-23-4
Formula:C19 H28 N4 O S
MolWeight:360.523
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | YM 230888 |
| CAS： | 446257-23-4 |
| English Synonyms： | YM 230888 |
| MDL Number.： | MFCD18086852 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1c(sc2c1c(ncn2)NC3CCCCCC3)CNC[C@H]4CCCO4 |
| InChi： | InChI=1S/C19H28N4OS/c1-2-4-7-14(6-3-1)23-18-17-10-16(25-19(17)22-13-21-18)12-20-11-15-8-5-9-24-15/h10,13-15,20H,1-9,11-12H2,(H,21,22,23)/t15-/m1/s1 |
| InChiKey： | InChIKey=SASNRPJKZVJWQW-OAHLLOKOSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
