* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX120055 |
English Synonyms: | WUXIAPPTEC WX120055 |
MDL Number.: | MFCD18089866 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)(C)OC(=O)N1C2CCC1(C[C@@H]2O)C(=O)O |
InChi: | InChI=1S/C12H19NO5/c1-11(2,3)18-10(17)13-7-4-5-12(13,9(15)16)6-8(7)14/h7-8,14H,4-6H2,1-3H3,(H,15,16)/t7?,8-,12?/m0/s1 |
InChiKey: | InChIKey=MMWLYNIDGURLNG-XIGTVVQJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.