* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105150 |
English Synonyms: | WUXIAPPTEC WX105150 |
MDL Number.: | MFCD18089868 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCOC(=O)[C@@]12CCC3([C@@H]1CNC2)CCN(CC3)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C19H32N2O4/c1-5-24-15(22)19-7-6-18(14(19)12-20-13-19)8-10-21(11-9-18)16(23)25-17(2,3)4/h14,20H,5-13H2,1-4H3/t14-,19+/m0/s1 |
InChiKey: | InChIKey=UDHKXXMUVKVFFR-IFXJQAMLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.