* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4-(4-IODOPHENOXY)-PHENOL |
CAS: | 26002-35-7 |
English Synonyms: | 4-(4-IODOPHENOXY)-PHENOL |
MDL Number.: | MFCD18207458 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(ccc1O)Oc2ccc(cc2)I |
InChi: | InChI=1S/C12H9IO2/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,14H |
InChiKey: | InChIKey=SEUYXXCZJLHQTO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.