* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8,9,10-TRIHYDROBENZO[2,1-H]CHROMANE-4,7-DIONE |
| English Synonyms: | 8,9,10-TRIHYDROBENZO[2,1-H]CHROMANE-4,7-DIONE |
| MDL Number.: | MFCD18208098 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc2c(c3c1C(=O)CCC3)OCCC2=O |
| InChi: | InChI=1S/C13H12O3/c14-11-3-1-2-9-8(11)4-5-10-12(15)6-7-16-13(9)10/h4-5H,1-3,6-7H2 |
| InChiKey: | InChIKey=LBFBGAHFTWJZGQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.