* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-CHLORO-1,7-NAPHTHYRIDIN-4-AMINE |
English Synonyms: | 8-CHLORO-1,7-NAPHTHYRIDIN-4-AMINE |
MDL Number.: | MFCD18250857 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cnc(c2c1c(ccn2)N)Cl |
InChi: | InChI=1S/C8H6ClN3/c9-8-7-5(1-3-12-8)6(10)2-4-11-7/h1-4H,(H2,10,11) |
InChiKey: | InChIKey=DDXILDRVOBWVPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.