* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-ETHOXY-1H-BENZO[D][1,3]OXAZINE-2,4-DIONE |
| English Synonyms: | 8-ETHOXY-1H-BENZO[D][1,3]OXAZINE-2,4-DIONE ; 8-ETHOXY-2,4-DIHYDRO-1H-3,1-BENZOXAZINE-2,4-DIONE |
| MDL Number.: | MFCD18251386 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOc1cccc2c1[nH]c(=O)oc2=O |
| InChi: | InChI=1S/C10H9NO4/c1-2-14-7-5-3-4-6-8(7)11-10(13)15-9(6)12/h3-5H,2H2,1H3,(H,11,13) |
| InChiKey: | InChIKey=VGKAUYQIJZNZBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.