* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WAY-260022 |
CAS: | 850692-43-2 |
English Synonyms: | WAY-260022 |
MDL Number.: | MFCD18251430 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C[C@@H]1CN(C[C@@H](N1)C)C[C@H](c2cccc(c2)OC(F)(F)F)C3(CCCCC3)O |
InChi: | InChI=1S/C21H31F3N2O2/c1-15-12-26(13-16(2)25-15)14-19(20(27)9-4-3-5-10-20)17-7-6-8-18(11-17)28-21(22,23)24/h6-8,11,15-16,19,25,27H,3-5,9-10,12-14H2,1-2H3/t15-,16+,19-/m1/s1 |
InChiKey: | InChIKey=ZNDZJNVJUAKEQC-JTDSTZFVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.