* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GSK-962040 |
| CAS: | 923565-22-4 ;923565-21-3 |
| English Synonyms: | 1-(4-[(3-FLUOROPHENYL)AMINO]PIPERIDIN-1-YL)-2-(4-([(3S)-3-METHYLPIPERAZIN-1-YL]METHYL)PHENYL)ETHAN-1-ONE ; GSK962040 (HCL SALT) ; GSK-962040 |
| MDL Number.: | MFCD18251559 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | C[C@H]1CN(CCN1)Cc2ccc(cc2)CC(=O)N3CCC(CC3)Nc4cccc(c4)F |
| InChi: | InChI=1S/C25H33FN4O/c1-19-17-29(14-11-27-19)18-21-7-5-20(6-8-21)15-25(31)30-12-9-23(10-13-30)28-24-4-2-3-22(26)16-24/h2-8,16,19,23,27-28H,9-15,17-18H2,1H3/t19-/m0/s1 |
| InChiKey: | InChIKey=RZKDEGZIFSJVNA-IBGZPJMESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.