* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WS 50030 |
CAS: | 889883-05-0 |
English Synonyms: | WS 50030 |
MDL Number.: | MFCD18251593 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)CC=C2CCCN3CCN(CC3)c4cccc5c4oc(=O)[nH]5 |
InChi: | InChI=1S/C23H25N3O2/c27-23-24-20-8-3-9-21(22(20)28-23)26-15-13-25(14-16-26)12-4-6-18-11-10-17-5-1-2-7-19(17)18/h1-3,5,7-9,11H,4,6,10,12-16H2,(H,24,27) |
InChiKey: | InChIKey=NBEGULJEDOLHOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.