* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUINIDINE 1'-OXIDE |
CAS: | 115730-97-7 |
English Synonyms: | QUINIDINE 1'-OXIDE |
MDL Number.: | MFCD18252351 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COc1ccc2c(c1)c(cc[n+]2[O-])[C@@H]([C@H]3C[C@H]4CCN3C[C@@H]4C=C)O |
InChi: | InChI=1S/C20H24N2O3/c1-3-13-12-21-8-6-14(13)10-19(21)20(23)16-7-9-22(24)18-5-4-15(25-2)11-17(16)18/h3-5,7,9,11,13-14,19-20,23H,1,6,8,10,12H2,2H3/t13-,14+,19+,20-/m0/s1 |
InChiKey: | InChIKey=GBBIANHNFAPFOH-SMHQJORMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.