* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,1'-(1,2-ETHYNEDIYL)BIS[2-CHLORO-BENZENE |
CAS: | 5293-77-6 |
English Synonyms: | BENZENE, 1,1'-(1,2-ETHYNEDIYL)BIS[2-CHLORO- ; 1,1'-(1,2-ETHYNEDIYL)BIS[2-CHLORO-BENZENE |
MDL Number.: | MFCD18252811 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc(c(c1)C#Cc2ccccc2Cl)Cl |
InChi: | InChI=1S/C14H8Cl2/c15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16/h1-8H |
InChiKey: | InChIKey=IWKTVIPYPZOUDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.