* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-2-METHYLQUINOLIN-5-OL |
| CAS: | 420786-78-3 |
| English Synonyms: | ABBYPHARMA AP-30-2811 ; 8-CHLORO-2-METHYLQUINOLIN-5-OL |
| MDL Number.: | MFCD18254930 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1ccc2c(ccc(c2n1)Cl)O |
| InChi: | InChI=1S/C10H8ClNO/c1-6-2-3-7-9(13)5-4-8(11)10(7)12-6/h2-5,13H,1H3 |
| InChiKey: | InChIKey=GRVQXFRJNJGBPE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.