* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHOXY-1,2,3,4-TETRAHYDRO-1,7-NAPHTHYRIDINE |
English Synonyms: | ABBYPHARMA AP-30-6541 ; 8-METHOXY-1,2,3,4-TETRAHYDRO-1,7-NAPHTHYRIDINE |
MDL Number.: | MFCD18257035 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COc1c2c(ccn1)CCCN2 |
InChi: | InChI=1S/C9H12N2O/c1-12-9-8-7(4-6-11-9)3-2-5-10-8/h4,6,10H,2-3,5H2,1H3 |
InChiKey: | InChIKey=IHGWAHAKQIOSBU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.