* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHOXY-1H,2H,3H,5H-PYRIDO[2,3-E][1,4]OXAZEPINE |
| English Synonyms: | 8-METHOXY-1H,2H,3H,5H-PYRIDO[2,3-E][1,4]OXAZEPINE ; ABBYPHARMA AP-31-2367 |
| MDL Number.: | MFCD18260676 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COc1ccc2c(n1)NCCOC2 |
| InChi: | InChI=1S/C9H12N2O2/c1-12-8-3-2-7-6-13-5-4-10-9(7)11-8/h2-3H,4-6H2,1H3,(H,10,11) |
| InChiKey: | InChIKey=JXBSWKQISGQSSE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.