* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO-1H,2H,3H,5H-PYRIDO[3,2-E][1,4]OXAZEPINE |
| English Synonyms: | 8-BROMO-1H,2H,3H,5H-PYRIDO[3,2-E][1,4]OXAZEPINE ; ABBYPHARMA AP-31-2375 |
| MDL Number.: | MFCD18260684 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1c(cnc2c1NCCOC2)Br |
| InChi: | InChI=1S/C8H9BrN2O/c9-6-3-7-8(11-4-6)5-12-2-1-10-7/h3-4,10H,1-2,5H2 |
| InChiKey: | InChIKey=YFROFTOBULJBRU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.