* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-BROMO-1H,2H,3H,5H-PYRIDO[3,2-E][1,4]OXAZEPIN-2-ONE |
English Synonyms: | ABBYPHARMA AP-31-2385 ; 8-BROMO-1H,2H,3H,5H-PYRIDO[3,2-E][1,4]OXAZEPIN-2-ONE |
MDL Number.: | MFCD18260694 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1c(cnc2c1NC(=O)COC2)Br |
InChi: | InChI=1S/C8H7BrN2O2/c9-5-1-6-7(10-2-5)3-13-4-8(12)11-6/h1-2H,3-4H2,(H,11,12) |
InChiKey: | InChIKey=HQAZELHOFRLTES-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.