* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(PROPAN-2-YL)-2,4-DIHYDRO-1H-3,1-BENZOXAZINE-2,4-DIONE |
English Synonyms: | 8-(PROPAN-2-YL)-2,4-DIHYDRO-1H-3,1-BENZOXAZINE-2,4-DIONE |
MDL Number.: | MFCD18269576 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)c1cccc2c1[nH]c(=O)oc2=O |
InChi: | InChI=1S/C11H11NO3/c1-6(2)7-4-3-5-8-9(7)12-11(14)15-10(8)13/h3-6H,1-2H3,(H,12,14) |
InChiKey: | InChIKey=JWUBQADRSOICKZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.