* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-AMINO-2-(1H-PYRROL-1-YL)-BENZOIC ACID |
CAS: | 55540-37-9 |
English Synonyms: | 5-AMINO-2-(1H-PYRROL-1-YL)-BENZOIC ACID ; BENZOIC ACID, 5-AMINO-2-(1H-PYRROL-1-YL)- |
MDL Number.: | MFCD18270842 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccn(c1)c2ccc(cc2C(=O)O)N |
InChi: | InChI=1S/C11H10N2O2/c12-8-3-4-10(9(7-8)11(14)15)13-5-1-2-6-13/h1-7H,12H2,(H,14,15) |
InChiKey: | InChIKey=YZXJJXKLVRCEDK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.