* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8,8,10-TRIMETHYL-3-AZASPIRO[5.5]UNDECANE-2,4-DIONE |
| English Synonyms: | 8,8,10-TRIMETHYL-3-AZASPIRO[5.5]UNDECANE-2,4-DIONE |
| MDL Number.: | MFCD18277007 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1CC(CC2(C1)CC(=O)NC(=O)C2)(C)C |
| InChi: | InChI=1S/C13H21NO2/c1-9-4-12(2,3)8-13(5-9)6-10(15)14-11(16)7-13/h9H,4-8H2,1-3H3,(H,14,15,16) |
| InChiKey: | InChIKey=RWQXNVJCHNERKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.