* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-CHLORO-3-(PROPAN-2-YL)QUINOLIN-2-AMINE |
English Synonyms: | 8-CHLORO-3-(PROPAN-2-YL)QUINOLIN-2-AMINE |
MDL Number.: | MFCD18299304 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)c1cc2cccc(c2nc1N)Cl |
InChi: | InChI=1S/C12H13ClN2/c1-7(2)9-6-8-4-3-5-10(13)11(8)15-12(9)14/h3-7H,1-2H3,(H2,14,15) |
InChiKey: | InChIKey=MWDDOLHWLDSPFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.