* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLIN-7-AMINE |
English Synonyms: | 8-METHYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLIN-7-AMINE |
MDL Number.: | MFCD18299502 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1cc2cc3c(cc2nc1N)OCCO3 |
InChi: | InChI=1S/C12H12N2O2/c1-7-4-8-5-10-11(16-3-2-15-10)6-9(8)14-12(7)13/h4-6H,2-3H2,1H3,(H2,13,14) |
InChiKey: | InChIKey=NRYOVJTWTXRGGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.