* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-CHLORO-4-(NAPHTHALEN-2-YL)PHENOL |
CAS: | 550997-94-9 |
English Synonyms: | 2-CHLORO-4-(NAPHTHALEN-2-YL)PHENOL |
MDL Number.: | MFCD18315626 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc2cc(ccc2c1)c3ccc(c(c3)Cl)O |
InChi: | InChI=1S/C16H11ClO/c17-15-10-14(7-8-16(15)18)13-6-5-11-3-1-2-4-12(11)9-13/h1-10,18H |
InChiKey: | InChIKey=NLFWTSXMRSTIKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.