* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (2,4)-DIHYDROXY-5-(FURAN-2-YL)PYRIMIDINE |
CAS: | 55625-98-4 |
English Synonyms: | 5-(FURAN-2-YL)PYRIMIDINE-2,4-DIOL ; (2,4)-DIHYDROXY-5-(FURAN-2-YL)PYRIMIDINE |
MDL Number.: | MFCD18316495 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(oc1)c2cnc(nc2O)O |
InChi: | InChI=1S/C8H6N2O3/c11-7-5(4-9-8(12)10-7)6-2-1-3-13-6/h1-4H,(H2,9,10,11,12) |
InChiKey: | InChIKey=BMCOODRJVHNWFL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.