* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(4-METHYLPYRIDIN-3-YL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
English Synonyms: | 8-(4-METHYLPYRIDIN-3-YL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
MDL Number.: | MFCD18332009 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccncc1N2C3CCC2CC(C3)N |
InChi: | InChI=1S/C13H19N3/c1-9-4-5-15-8-13(9)16-11-2-3-12(16)7-10(14)6-11/h4-5,8,10-12H,2-3,6-7,14H2,1H3 |
InChiKey: | InChIKey=JHHYMECFYFGBJI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.