* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4-METHYL-6-HEPTEN-3-OL |
CAS: | 53907-71-4 |
English Synonyms: | 4-METHYL-6-HEPTEN-3-OL ; 4-METHYLHEPT-6-EN-3-OL |
MDL Number.: | MFCD18362943 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC(C(C)CC=C)O |
InChi: | InChI=1S/C8H16O/c1-4-6-7(3)8(9)5-2/h4,7-9H,1,5-6H2,2-3H3 |
InChiKey: | InChIKey=QMMJAABEFZXPBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.