* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(OXOLAN-3-YLOXY)-1,2,3,4-TETRAHYDROQUINOLINE |
English Synonyms: | 8-(OXOLAN-3-YLOXY)-1,2,3,4-TETRAHYDROQUINOLINE |
MDL Number.: | MFCD18366435 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2c(c(c1)OC3CCOC3)NCCC2 |
InChi: | InChI=1S/C13H17NO2/c1-3-10-4-2-7-14-13(10)12(5-1)16-11-6-8-15-9-11/h1,3,5,11,14H,2,4,6-9H2 |
InChiKey: | InChIKey=PZSPMBAYPFYZGJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.