* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5H,7H,8H-PYRANO[4,3-B]PYRIDIN-5-ONE |
CAS: | 5860-72-0 |
English Synonyms: | 7,8-DIHYDRO-5H-PYRANO[4,3-B]PYRIDIN-5-ONE ; 5H,7H,8H-PYRANO[4,3-B]PYRIDIN-5-ONE |
MDL Number.: | MFCD18384703 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc2c(nc1)CCOC2=O |
InChi: | InChI=1S/C8H7NO2/c10-8-6-2-1-4-9-7(6)3-5-11-8/h1-2,4H,3,5H2 |
InChiKey: | InChIKey=ZRYAAXCYVDXIMT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.