* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-AMINO-2-HYDROXYQUINOLINE |
| CAS: | 53868-02-3 |
| English Synonyms: | 8-AMINO-2-HYDROXYQUINOLINE |
| MDL Number.: | MFCD18413407 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc2ccc(nc2c(c1)N)O |
| InChi: | InChI=1S/C9H8N2O/c10-7-3-1-2-6-4-5-8(12)11-9(6)7/h1-5H,10H2,(H,11,12) |
| InChiKey: | InChIKey=RYXAGNHPWGDUPR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.