* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-[6-(1,4-DIAZEPAN-1-YL)PYRIMIDIN-4-YL]QUINOLINE |
| English Synonyms: | 8-[6-(1,4-DIAZEPAN-1-YL)PYRIMIDIN-4-YL]QUINOLINE |
| MDL Number.: | MFCD18425738 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cc2cccnc2c(c1)c3cc(ncn3)N4CCCNCC4 |
| InChi: | InChI=1S/C18H19N5/c1-4-14-5-2-8-20-18(14)15(6-1)16-12-17(22-13-21-16)23-10-3-7-19-9-11-23/h1-2,4-6,8,12-13,19H,3,7,9-11H2 |
| InChiKey: | InChIKey=AURTYSWNWOZDCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.