* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-CHLORO-6-PHENYL-2,4-DIHYDRO-1H-[1,2,4]TRIAZOLO[4,3-A][1,4]BENZODIAZEPIN-1-ONE |
English Synonyms: | 8-CHLORO-6-PHENYL-2,4-DIHYDRO-1H-[1,2,4]TRIAZOLO[4,3-A][1,4]BENZODIAZEPIN-1-ONE |
MDL Number.: | MFCD18429255 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)C2=NCc3n[nH]c(=O)n3-c4c2cc(cc4)Cl |
InChi: | InChI=1S/C16H11ClN4O/c17-11-6-7-13-12(8-11)15(10-4-2-1-3-5-10)18-9-14-19-20-16(22)21(13)14/h1-8H,9H2,(H,20,22) |
InChiKey: | InChIKey=BKXMIHOSZZYXDH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.