* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-2-METHYL-6-PHENYL-2,4-DIHYDRO-1H-[1,2,4]TRIAZOLO[4,3-A][1,4]BENZODIAZEPIN-1-ONE |
| English Synonyms: | 8-CHLORO-2-METHYL-6-PHENYL-2,4-DIHYDRO-1H-[1,2,4]TRIAZOLO[4,3-A][1,4]BENZODIAZEPIN-1-ONE |
| MDL Number.: | MFCD18429260 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | Cn1c(=O)n-2c(n1)CN=C(c3c2ccc(c3)Cl)c4ccccc4 |
| InChi: | InChI=1S/C17H13ClN4O/c1-21-17(23)22-14-8-7-12(18)9-13(14)16(19-10-15(22)20-21)11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
| InChiKey: | InChIKey=ASJCMUJNNXXSQM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.